C14H15F3N4O3 — CID 75477942
1-(1-methylpyrazol-4-yl)-6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide (PubChem CID 75477942) has the molecular formula C14H15F3N4O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide.
| Compound Name | 1-(1-methylpyrazol-4-yl)-6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75477942 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
| SMILES | Cn1cc(-n2cc(C(=O)NCCOCC(F)(F)F)ccc2=O)cn1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-20-8-11(6-19-20)21-7-10(2-3-12(21)22)13(23)18-4-5-24-9-14(15,16)17/h2-3,6-8H,4-5,9H2,1H3,(H,18,23) |
| InChIKey | SCMGHTPIGMESDS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|