C18H19N3O3 — CID 75477992
methyl 3-(N-(4-cyano-1-methylpyrrole-2-carbonyl)-2-methylanilino)propanoate (PubChem CID 75477992) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 3-(N-(4-cyano-1-methylpyrrole-2-carbonyl)-2-methylanilino)propanoate.
| Compound Name | methyl 3-(N-(4-cyano-1-methylpyrrole-2-carbonyl)-2-methylanilino)propanoate |
|---|---|
| PubChem CID | 75477992 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | methyl 3-(N-(4-cyano-1-methylpyrrole-2-carbonyl)-2-methylanilino)propanoate |
| SMILES | COC(=O)CCN(C(=O)c1cc(C#N)cn1C)c1ccccc1C |
| InChI | InChI=1S/C18H19N3O3/c1-13-6-4-5-7-15(13)21(9-8-17(22)24-3)18(23)16-10-14(11-19)12-20(16)2/h4-7,10,12H,8-9H2,1-3H3 |
| InChIKey | ZTBWWDRAXOXQKV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |