C16H16F2N4O — CID 75478044
4-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carboxamide (PubChem CID 75478044) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carboxamide.
| Compound Name | 4-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75478044 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H16F2N4O/c17-10-1-2-15(13(18)7-10)22-6-4-11(9-22)21-14-3-5-20-8-12(14)16(19)23/h1-3,5,7-8,11H,4,6,9H2,(H2,19,23)(H,20,21) |
| InChIKey | ZBWNLIIOEYYERC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |