C15H20ClN3O4 — CID 75478760
3-chloro-N-[2-(4-methoxypiperidin-1-yl)ethyl]-4-nitrobenzamide (PubChem CID 75478760) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-methoxypiperidin-1-yl)ethyl]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[2-(4-methoxypiperidin-1-yl)ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 75478760 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-chloro-N-[2-(4-methoxypiperidin-1-yl)ethyl]-4-nitrobenzamide |
| SMILES | COC1CCN(CCNC(=O)c2ccc([N+](=O)[O-])c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClN3O4/c1-23-12-4-7-18(8-5-12)9-6-17-15(20)11-2-3-14(19(21)22)13(16)10-11/h2-3,10,12H,4-9H2,1H3,(H,17,20) |
| InChIKey | DOACVOGFEZOXMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|