About 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane
1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane (PubChem CID 75478926) has the molecular formula C15H28F3N3
and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane |
| PubChem CID | 75478926 |
| Molecular Formula | C15H28F3N3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane |
| SMILES | FC(F)(F)CN1CCCN(CCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C15H28F3N3/c16-15(17,18)14-21-11-5-10-20(12-13-21)9-4-8-19-6-2-1-3-7-19/h1-14H2 |
| InChIKey | AVGVLVQLORCVSR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane?
The IUPAC name of 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane (CID 75478926) is 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane.
What is the SMILES notation for 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane?
The canonical SMILES for 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane is FC(F)(F)CN1CCCN(CCCN2CCCCC2)CC1.
What is the InChIKey of 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane?
The InChIKey is AVGVLVQLORCVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F3N3/c16-15(17,18)14-21-11-5-10-20(12-13-21)9-4-8-19-6-2-1-3-7-19/h1-14H2.
What are the key properties of 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane?
1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane has a molecular weight of 307.40 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-piperidin-1-ylpropyl)-4-(2,2,2-trifluoroethyl)-1,4-diazepane is sourced from PubChem (CID 75478926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).