About (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid
(2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 7547931) has the molecular formula C14H13N3O3
and a molecular weight of 271.28 g/mol. Its IUPAC name is (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid.
Molecular Properties
| Compound Name | (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid |
| PubChem CID | 7547931 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | CC[C@@H](Nc1ncnc2c1oc1ccccc12)C(=O)O |
| InChI | InChI=1S/C14H13N3O3/c1-2-9(14(18)19)17-13-12-11(15-7-16-13)8-5-3-4-6-10(8)20-12/h3-7,9H,2H2,1H3,(H,18,19)(H,15,16,17)/t9-/m1/s1 |
| InChIKey | UGRPWCYTNUVERB-SECBINFHSA-N |
| XLogP | 2.65 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid?
The IUPAC name of (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid (CID 7547931) is (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid.
What is the SMILES notation for (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid?
The canonical SMILES for (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid is CC[C@@H](Nc1ncnc2c1oc1ccccc12)C(=O)O.
What is the InChIKey of (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid?
The InChIKey is UGRPWCYTNUVERB-SECBINFHSA-N. The full InChI is InChI=1S/C14H13N3O3/c1-2-9(14(18)19)17-13-12-11(15-7-16-13)8-5-3-4-6-10(8)20-12/h3-7,9H,2H2,1H3,(H,18,19)(H,15,16,17)/t9-/m1/s1.
What are the key properties of (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid?
(2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid has a molecular weight of 271.28 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)butanoic acid is sourced from PubChem (CID 7547931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).