About (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride
(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (PubChem CID 75480384) has the molecular formula C5H12Cl2N4S
and a molecular weight of 231.15 g/mol. Its IUPAC name is (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| PubChem CID | 75480384 |
| Molecular Formula | C5H12Cl2N4S |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| SMILES | CSc1nnc(CN)n1C.Cl.Cl |
| InChI | InChI=1S/C5H10N4S.2ClH/c1-9-4(3-6)7-8-5(9)10-2;;/h3,6H2,1-2H3;2*1H |
| InChIKey | HFKDXNIOFKQBGV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The IUPAC name of (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CID 75480384) is (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is CSc1nnc(CN)n1C.Cl.Cl.
What is the InChIKey of (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The InChIKey is HFKDXNIOFKQBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S.2ClH/c1-9-4(3-6)7-8-5(9)10-2;;/h3,6H2,1-2H3;2*1H.
What are the key properties of (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride has a molecular weight of 231.15 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 75480384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).