About methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 75480505) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 75480505 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCCC1=NC(C(=O)OC)CO1 |
| InChI | InChI=1S/C8H13NO3/c1-3-4-7-9-6(5-12-7)8(10)11-2/h6H,3-5H2,1-2H3 |
| InChIKey | INJLPVOPGYBYKJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 75480505) is methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate is CCCC1=NC(C(=O)OC)CO1.
What is the InChIKey of methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is INJLPVOPGYBYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-4-7-9-6(5-12-7)8(10)11-2/h6H,3-5H2,1-2H3.
What are the key properties of methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 171.20 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-propyl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 75480505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).