About (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride
(5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (PubChem CID 75480562) has the molecular formula C8H16Cl2N4
and a molecular weight of 239.15 g/mol. Its IUPAC name is (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| PubChem CID | 75480562 |
| Molecular Formula | C8H16Cl2N4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(CN)nnc1C1CCC1 |
| InChI | InChI=1S/C8H14N4.2ClH/c1-12-7(5-9)10-11-8(12)6-3-2-4-6;;/h6H,2-5,9H2,1H3;2*1H |
| InChIKey | HSBRSDUFUJIPHL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The IUPAC name of (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CID 75480562) is (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is Cl.Cl.Cn1c(CN)nnc1C1CCC1.
What is the InChIKey of (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The InChIKey is HSBRSDUFUJIPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.2ClH/c1-12-7(5-9)10-11-8(12)6-3-2-4-6;;/h6H,2-5,9H2,1H3;2*1H.
What are the key properties of (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
(5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclobutyl-4-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 75480562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).