5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride

C8H6Cl2O3S — CID 75480629

IUPAC5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)cc2c1OCC2
InChIInChI=1S/C8H6Cl2O3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2
InChIKeyQOCMCTGCKAMOPC-UHFFFAOYSA-N
MW253.11 g/mol
LogP2.20
Rot. Bonds1

About 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride

5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (PubChem CID 75480629) has the molecular formula C8H6Cl2O3S and a molecular weight of 253.11 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride.

Molecular Properties

Compound Name5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride
PubChem CID75480629
Molecular FormulaC8H6Cl2O3S
Molecular Weight253.11 g/mol
Exact Mass251.94
IUPAC Name5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Cl)cc2c1OCC2
InChIInChI=1S/C8H6Cl2O3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2
InChIKeyQOCMCTGCKAMOPC-UHFFFAOYSA-N
XLogP2.20
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.11
LogP ≤ 52.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CID 75480629) is 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride.
What is the SMILES notation for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The canonical SMILES for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)cc2c1OCC2.
What is the InChIKey of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The InChIKey is QOCMCTGCKAMOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2.
What are the key properties of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride has a molecular weight of 253.11 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride is sourced from PubChem (CID 75480629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).