About 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride
5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (PubChem CID 75480629) has the molecular formula C8H6Cl2O3S
and a molecular weight of 253.11 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| PubChem CID | 75480629 |
| Molecular Formula | C8H6Cl2O3S |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C8H6Cl2O3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2 |
| InChIKey | QOCMCTGCKAMOPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The IUPAC name of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CID 75480629) is 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride.
What is the SMILES notation for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The canonical SMILES for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)cc2c1OCC2.
What is the InChIKey of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
The InChIKey is QOCMCTGCKAMOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2.
What are the key properties of 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride?
5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride has a molecular weight of 253.11 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl chloride is sourced from PubChem (CID 75480629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).