C4H9IN4 — CID 75480754
2,5-dimethyl-1,2,4-triazol-3-amine;hydroiodide (PubChem CID 75480754) has the molecular formula C4H9IN4 and a molecular weight of 240.05 g/mol. Its IUPAC name is 2,5-dimethyl-1,2,4-triazol-3-amine;hydroiodide.
| Compound Name | 2,5-dimethyl-1,2,4-triazol-3-amine;hydroiodide |
|---|---|
| PubChem CID | 75480754 |
| Molecular Formula | C4H9IN4 |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2,5-dimethyl-1,2,4-triazol-3-amine;hydroiodide |
| SMILES | Cc1nc(N)n(C)n1.I |
| InChI | InChI=1S/C4H8N4.HI/c1-3-6-4(5)8(2)7-3;/h1-2H3,(H2,5,6,7);1H |
| InChIKey | UEPYMKSSFRNQGX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|