About (2R)-2,3-diaminopropan-1-ol;dihydrochloride
(2R)-2,3-diaminopropan-1-ol;dihydrochloride (PubChem CID 75480765) has the molecular formula C3H12Cl2N2O
and a molecular weight of 163.05 g/mol. Its IUPAC name is (2R)-2,3-diaminopropan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | (2R)-2,3-diaminopropan-1-ol;dihydrochloride |
| PubChem CID | 75480765 |
| Molecular Formula | C3H12Cl2N2O |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | (2R)-2,3-diaminopropan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.NC[C@@H](N)CO |
| InChI | InChI=1S/C3H10N2O.2ClH/c4-1-3(5)2-6;;/h3,6H,1-2,4-5H2;2*1H/t3-;;/m1../s1 |
| InChIKey | IKBUWJHUBADHSZ-HWYNEVGZSA-N |
| XLogP | -0.89 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2,3-diaminopropan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-diaminopropan-1-ol;dihydrochloride?
The IUPAC name of (2R)-2,3-diaminopropan-1-ol;dihydrochloride (CID 75480765) is (2R)-2,3-diaminopropan-1-ol;dihydrochloride.
What is the SMILES notation for (2R)-2,3-diaminopropan-1-ol;dihydrochloride?
The canonical SMILES for (2R)-2,3-diaminopropan-1-ol;dihydrochloride is Cl.Cl.NC[C@@H](N)CO.
What is the InChIKey of (2R)-2,3-diaminopropan-1-ol;dihydrochloride?
The InChIKey is IKBUWJHUBADHSZ-HWYNEVGZSA-N. The full InChI is InChI=1S/C3H10N2O.2ClH/c4-1-3(5)2-6;;/h3,6H,1-2,4-5H2;2*1H/t3-;;/m1../s1.
What are the key properties of (2R)-2,3-diaminopropan-1-ol;dihydrochloride?
(2R)-2,3-diaminopropan-1-ol;dihydrochloride has a molecular weight of 163.05 g/mol, XLogP of -0.89, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-diaminopropan-1-ol;dihydrochloride is sourced from PubChem (CID 75480765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).