About 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride
2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride (PubChem CID 75480797) has the molecular formula C9H16ClN3O2
and a molecular weight of 233.70 g/mol. Its IUPAC name is 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride |
| PubChem CID | 75480797 |
| Molecular Formula | C9H16ClN3O2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride |
| SMILES | CC(C)c1nc(C2CNCCO2)no1.Cl |
| InChI | InChI=1S/C9H15N3O2.ClH/c1-6(2)9-11-8(12-14-9)7-5-10-3-4-13-7;/h6-7,10H,3-5H2,1-2H3;1H |
| InChIKey | AAZODQXRCNVBTK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride?
The IUPAC name of 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride (CID 75480797) is 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride.
What is the SMILES notation for 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride?
The canonical SMILES for 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride is CC(C)c1nc(C2CNCCO2)no1.Cl.
What is the InChIKey of 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride?
The InChIKey is AAZODQXRCNVBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.ClH/c1-6(2)9-11-8(12-14-9)7-5-10-3-4-13-7;/h6-7,10H,3-5H2,1-2H3;1H.
What are the key properties of 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride?
2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride has a molecular weight of 233.70 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)morpholine;hydrochloride is sourced from PubChem (CID 75480797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).