About [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride
[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (PubChem CID 75480800) has the molecular formula C4H6ClF3N4
and a molecular weight of 202.57 g/mol. Its IUPAC name is [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| PubChem CID | 75480800 |
| Molecular Formula | C4H6ClF3N4 |
| Molecular Weight | 202.57 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C4H5F3N4.ClH/c5-4(6,7)3-9-2(1-8)10-11-3;/h1,8H2,(H,9,10,11);1H |
| InChIKey | XDDZIMVDOKJDSC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.57 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The IUPAC name of [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CID 75480800) is [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride.
What is the SMILES notation for [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The canonical SMILES for [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride is Cl.NCc1nc(C(F)(F)F)n[nH]1.
What is the InChIKey of [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
The InChIKey is XDDZIMVDOKJDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3N4.ClH/c5-4(6,7)3-9-2(1-8)10-11-3;/h1,8H2,(H,9,10,11);1H.
What are the key properties of [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride?
[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride has a molecular weight of 202.57 g/mol, XLogP of 0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride is sourced from PubChem (CID 75480800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).