C12H16ClN3O — CID 75480838
4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride (PubChem CID 75480838) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride.
| Compound Name | 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 75480838 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride |
| SMILES | CCCc1noc(Cc2ccc(N)cc2)n1.Cl |
| InChI | InChI=1S/C12H15N3O.ClH/c1-2-3-11-14-12(16-15-11)8-9-4-6-10(13)7-5-9;/h4-7H,2-3,8,13H2,1H3;1H |
| InChIKey | NGSAABHZKQBLSO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|