About 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride (PubChem CID 75480866) has the molecular formula C10H12ClN3O
and a molecular weight of 225.68 g/mol. Its IUPAC name is 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride |
| PubChem CID | 75480866 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride |
| SMILES | Cc1noc(Cc2ccc(N)cc2)n1.Cl |
| InChI | InChI=1S/C10H11N3O.ClH/c1-7-12-10(14-13-7)6-8-2-4-9(11)5-3-8;/h2-5H,6,11H2,1H3;1H |
| InChIKey | FQXFUNGGYGTBQW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride?
The IUPAC name of 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride (CID 75480866) is 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride.
What is the SMILES notation for 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride?
The canonical SMILES for 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride is Cc1noc(Cc2ccc(N)cc2)n1.Cl.
What is the InChIKey of 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride?
The InChIKey is FQXFUNGGYGTBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.ClH/c1-7-12-10(14-13-7)6-8-2-4-9(11)5-3-8;/h2-5H,6,11H2,1H3;1H.
What are the key properties of 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride?
4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride has a molecular weight of 225.68 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline;hydrochloride is sourced from PubChem (CID 75480866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).