About 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride
2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride (PubChem CID 75480928) has the molecular formula C7H14Cl2N4S
and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride |
| PubChem CID | 75480928 |
| Molecular Formula | C7H14Cl2N4S |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride |
| SMILES | Cc1nnc(N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C7H12N4S.2ClH/c1-6-9-10-7(12-6)11-4-2-8-3-5-11;;/h8H,2-5H2,1H3;2*1H |
| InChIKey | HIUYWQFEHUHGGO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride?
The IUPAC name of 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride (CID 75480928) is 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride.
What is the SMILES notation for 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride?
The canonical SMILES for 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride is Cc1nnc(N2CCNCC2)s1.Cl.Cl.
What is the InChIKey of 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride?
The InChIKey is HIUYWQFEHUHGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4S.2ClH/c1-6-9-10-7(12-6)11-4-2-8-3-5-11;;/h8H,2-5H2,1H3;2*1H.
What are the key properties of 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride?
2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride has a molecular weight of 257.19 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-piperazin-1-yl-1,3,4-thiadiazole;dihydrochloride is sourced from PubChem (CID 75480928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).