About 3-(methoxymethyl)-1,2-oxazole-5-carboxamide
3-(methoxymethyl)-1,2-oxazole-5-carboxamide (PubChem CID 75481011) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-(methoxymethyl)-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-1,2-oxazole-5-carboxamide |
| PubChem CID | 75481011 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 3-(methoxymethyl)-1,2-oxazole-5-carboxamide |
| SMILES | COCc1cc(C(N)=O)on1 |
| InChI | InChI=1S/C6H8N2O3/c1-10-3-4-2-5(6(7)9)11-8-4/h2H,3H2,1H3,(H2,7,9) |
| InChIKey | HGCZYKRXZMYDCU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methoxymethyl)-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-(methoxymethyl)-1,2-oxazole-5-carboxamide (CID 75481011) is 3-(methoxymethyl)-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-(methoxymethyl)-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-(methoxymethyl)-1,2-oxazole-5-carboxamide is COCc1cc(C(N)=O)on1.
What is the InChIKey of 3-(methoxymethyl)-1,2-oxazole-5-carboxamide?
The InChIKey is HGCZYKRXZMYDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-10-3-4-2-5(6(7)9)11-8-4/h2H,3H2,1H3,(H2,7,9).
What are the key properties of 3-(methoxymethyl)-1,2-oxazole-5-carboxamide?
3-(methoxymethyl)-1,2-oxazole-5-carboxamide has a molecular weight of 156.14 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 75481011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).