About 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride
3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride (PubChem CID 75481032) has the molecular formula C10H12ClNOS
and a molecular weight of 229.73 g/mol. Its IUPAC name is 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride |
| PubChem CID | 75481032 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride |
| SMILES | Cl.OCCCc1cnc2ccsc2c1 |
| InChI | InChI=1S/C10H11NOS.ClH/c12-4-1-2-8-6-10-9(11-7-8)3-5-13-10;/h3,5-7,12H,1-2,4H2;1H |
| InChIKey | XFKHNDLXNBDENE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride?
The IUPAC name of 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride (CID 75481032) is 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride.
What is the SMILES notation for 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride?
The canonical SMILES for 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride is Cl.OCCCc1cnc2ccsc2c1.
What is the InChIKey of 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride?
The InChIKey is XFKHNDLXNBDENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS.ClH/c12-4-1-2-8-6-10-9(11-7-8)3-5-13-10;/h3,5-7,12H,1-2,4H2;1H.
What are the key properties of 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride?
3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride has a molecular weight of 229.73 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thieno[3,2-b]pyridin-6-ylpropan-1-ol;hydrochloride is sourced from PubChem (CID 75481032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).