About 4-pyrrol-1-ylpiperidine;hydrochloride
4-pyrrol-1-ylpiperidine;hydrochloride (PubChem CID 75481267) has the molecular formula C9H15ClN2
and a molecular weight of 186.69 g/mol. Its IUPAC name is 4-pyrrol-1-ylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-pyrrol-1-ylpiperidine;hydrochloride |
| PubChem CID | 75481267 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-pyrrol-1-ylpiperidine;hydrochloride |
| SMILES | Cl.c1ccn(C2CCNCC2)c1 |
| InChI | InChI=1S/C9H14N2.ClH/c1-2-8-11(7-1)9-3-5-10-6-4-9;/h1-2,7-10H,3-6H2;1H |
| InChIKey | MHNPNYOMZXQERX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-pyrrol-1-ylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrol-1-ylpiperidine;hydrochloride?
The IUPAC name of 4-pyrrol-1-ylpiperidine;hydrochloride (CID 75481267) is 4-pyrrol-1-ylpiperidine;hydrochloride.
What is the SMILES notation for 4-pyrrol-1-ylpiperidine;hydrochloride?
The canonical SMILES for 4-pyrrol-1-ylpiperidine;hydrochloride is Cl.c1ccn(C2CCNCC2)c1.
What is the InChIKey of 4-pyrrol-1-ylpiperidine;hydrochloride?
The InChIKey is MHNPNYOMZXQERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.ClH/c1-2-8-11(7-1)9-3-5-10-6-4-9;/h1-2,7-10H,3-6H2;1H.
What are the key properties of 4-pyrrol-1-ylpiperidine;hydrochloride?
4-pyrrol-1-ylpiperidine;hydrochloride has a molecular weight of 186.69 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrol-1-ylpiperidine;hydrochloride is sourced from PubChem (CID 75481267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).