About N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine (PubChem CID 75481269) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine |
| PubChem CID | 75481269 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1CCC=CO1 |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)6-11-5-7-3-1-2-4-12-7/h2,4,7-8,11H,1,3,5-6H2 |
| InChIKey | MFTQTZREHFMMFE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine?
The IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine (CID 75481269) is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine.
What is the SMILES notation for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine?
The canonical SMILES for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine is FC(F)CNCC1CCC=CO1.
What is the InChIKey of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine?
The InChIKey is MFTQTZREHFMMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO/c9-8(10)6-11-5-7-3-1-2-4-12-7/h2,4,7-8,11H,1,3,5-6H2.
What are the key properties of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine?
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine has a molecular weight of 177.19 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-difluoroethanamine is sourced from PubChem (CID 75481269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).