About tert-butyl 3-amino-1,2,4-triazole-1-carboxylate
tert-butyl 3-amino-1,2,4-triazole-1-carboxylate (PubChem CID 75481316) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is tert-butyl 3-amino-1,2,4-triazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-1,2,4-triazole-1-carboxylate |
| PubChem CID | 75481316 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | tert-butyl 3-amino-1,2,4-triazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(N)n1 |
| InChI | InChI=1S/C7H12N4O2/c1-7(2,3)13-6(12)11-4-9-5(8)10-11/h4H,1-3H3,(H2,8,10) |
| InChIKey | FJXSRCUWKNZLHE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-amino-1,2,4-triazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-1,2,4-triazole-1-carboxylate?
The IUPAC name of tert-butyl 3-amino-1,2,4-triazole-1-carboxylate (CID 75481316) is tert-butyl 3-amino-1,2,4-triazole-1-carboxylate.
What is the SMILES notation for tert-butyl 3-amino-1,2,4-triazole-1-carboxylate?
The canonical SMILES for tert-butyl 3-amino-1,2,4-triazole-1-carboxylate is CC(C)(C)OC(=O)n1cnc(N)n1.
What is the InChIKey of tert-butyl 3-amino-1,2,4-triazole-1-carboxylate?
The InChIKey is FJXSRCUWKNZLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-7(2,3)13-6(12)11-4-9-5(8)10-11/h4H,1-3H3,(H2,8,10).
What are the key properties of tert-butyl 3-amino-1,2,4-triazole-1-carboxylate?
tert-butyl 3-amino-1,2,4-triazole-1-carboxylate has a molecular weight of 184.20 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-1,2,4-triazole-1-carboxylate is sourced from PubChem (CID 75481316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).