About (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride
(2,2-dimethyloxan-4-yl)hydrazine;hydrochloride (PubChem CID 75481342) has the molecular formula C7H17ClN2O
and a molecular weight of 180.68 g/mol. Its IUPAC name is (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride |
| PubChem CID | 75481342 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride |
| SMILES | CC1(C)CC(NN)CCO1.Cl |
| InChI | InChI=1S/C7H16N2O.ClH/c1-7(2)5-6(9-8)3-4-10-7;/h6,9H,3-5,8H2,1-2H3;1H |
| InChIKey | HMPWFODLLWAQIN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride?
The IUPAC name of (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride (CID 75481342) is (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride.
What is the SMILES notation for (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride?
The canonical SMILES for (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride is CC1(C)CC(NN)CCO1.Cl.
What is the InChIKey of (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride?
The InChIKey is HMPWFODLLWAQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.ClH/c1-7(2)5-6(9-8)3-4-10-7;/h6,9H,3-5,8H2,1-2H3;1H.
What are the key properties of (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride?
(2,2-dimethyloxan-4-yl)hydrazine;hydrochloride has a molecular weight of 180.68 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyloxan-4-yl)hydrazine;hydrochloride is sourced from PubChem (CID 75481342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).