About (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride
(4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride (PubChem CID 75481674) has the molecular formula C5H10ClF2NO
and a molecular weight of 173.59 g/mol. Its IUPAC name is (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride.
Molecular Properties
| Compound Name | (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride |
| PubChem CID | 75481674 |
| Molecular Formula | C5H10ClF2NO |
| Molecular Weight | 173.59 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride |
| SMILES | Cl.OCC1CC(F)(F)CN1 |
| InChI | InChI=1S/C5H9F2NO.ClH/c6-5(7)1-4(2-9)8-3-5;/h4,8-9H,1-3H2;1H |
| InChIKey | JWAVXSQHRZARDV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.59 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride?
The IUPAC name of (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride (CID 75481674) is (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride.
What is the SMILES notation for (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride?
The canonical SMILES for (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride is Cl.OCC1CC(F)(F)CN1.
What is the InChIKey of (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride?
The InChIKey is JWAVXSQHRZARDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO.ClH/c6-5(7)1-4(2-9)8-3-5;/h4,8-9H,1-3H2;1H.
What are the key properties of (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride?
(4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride has a molecular weight of 173.59 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluoropyrrolidin-2-yl)methanol;hydrochloride is sourced from PubChem (CID 75481674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).