About ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride
ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride (PubChem CID 75481698) has the molecular formula C6H11ClN4O2
and a molecular weight of 206.63 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride |
| PubChem CID | 75481698 |
| Molecular Formula | C6H11ClN4O2 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1n[nH]c(CN)n1.Cl |
| InChI | InChI=1S/C6H10N4O2.ClH/c1-2-12-6(11)5-8-4(3-7)9-10-5;/h2-3,7H2,1H3,(H,8,9,10);1H |
| InChIKey | CJTDJMMJYFZMCR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride?
The IUPAC name of ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride (CID 75481698) is ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride?
The canonical SMILES for ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride is CCOC(=O)c1n[nH]c(CN)n1.Cl.
What is the InChIKey of ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride?
The InChIKey is CJTDJMMJYFZMCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2.ClH/c1-2-12-6(11)5-8-4(3-7)9-10-5;/h2-3,7H2,1H3,(H,8,9,10);1H.
What are the key properties of ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride?
ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride has a molecular weight of 206.63 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(aminomethyl)-1H-1,2,4-triazole-3-carboxylate;hydrochloride is sourced from PubChem (CID 75481698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).