About 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide
1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide (PubChem CID 75481743) has the molecular formula C10H23Br3N2
and a molecular weight of 411.02 g/mol. Its IUPAC name is 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide |
| PubChem CID | 75481743 |
| Molecular Formula | C10H23Br3N2 |
| Molecular Weight | 411.02 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide |
| SMILES | Br.Br.CC(C)N1CCN(CCCBr)CC1 |
| InChI | InChI=1S/C10H21BrN2.2BrH/c1-10(2)13-8-6-12(7-9-13)5-3-4-11;;/h10H,3-9H2,1-2H3;2*1H |
| InChIKey | CCYDUJRWEHJQAV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.02 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide?
The IUPAC name of 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide (CID 75481743) is 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide.
What is the SMILES notation for 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide?
The canonical SMILES for 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide is Br.Br.CC(C)N1CCN(CCCBr)CC1.
What is the InChIKey of 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide?
The InChIKey is CCYDUJRWEHJQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21BrN2.2BrH/c1-10(2)13-8-6-12(7-9-13)5-3-4-11;;/h10H,3-9H2,1-2H3;2*1H.
What are the key properties of 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide?
1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide has a molecular weight of 411.02 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-4-propan-2-ylpiperazine;dihydrobromide is sourced from PubChem (CID 75481743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).