About (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine
(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine (PubChem CID 75481759) has the molecular formula C4H7N3S2
and a molecular weight of 161.26 g/mol. Its IUPAC name is (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine |
| PubChem CID | 75481759 |
| Molecular Formula | C4H7N3S2 |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine |
| SMILES | CSc1nnc(CN)s1 |
| InChI | InChI=1S/C4H7N3S2/c1-8-4-7-6-3(2-5)9-4/h2,5H2,1H3 |
| InChIKey | NNNNOFHPMIZNKM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine?
The IUPAC name of (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine (CID 75481759) is (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine.
What is the SMILES notation for (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine?
The canonical SMILES for (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine is CSc1nnc(CN)s1.
What is the InChIKey of (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine?
The InChIKey is NNNNOFHPMIZNKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S2/c1-8-4-7-6-3(2-5)9-4/h2,5H2,1H3.
What are the key properties of (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine?
(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine has a molecular weight of 161.26 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methanamine is sourced from PubChem (CID 75481759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).