About 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline
4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 75481796) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 75481796 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CNc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-13-11-17-15-9-5-6-10-16(15)18(13)12-14-7-3-2-4-8-14/h2-10,13,17H,11-12H2,1H3 |
| InChIKey | XWLZXBWZCSXKFQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline (CID 75481796) is 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline is CC1CNc2ccccc2N1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is XWLZXBWZCSXKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-13-11-17-15-9-5-6-10-16(15)18(13)12-14-7-3-2-4-8-14/h2-10,13,17H,11-12H2,1H3.
What are the key properties of 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline?
4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 238.33 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-methyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 75481796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).