About (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride
(2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride (PubChem CID 75481807) has the molecular formula C8H15Cl2N3
and a molecular weight of 224.13 g/mol. Its IUPAC name is (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride |
| PubChem CID | 75481807 |
| Molecular Formula | C8H15Cl2N3 |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride |
| SMILES | Cc1nc(C)c(CN)c(C)n1.Cl.Cl |
| InChI | InChI=1S/C8H13N3.2ClH/c1-5-8(4-9)6(2)11-7(3)10-5;;/h4,9H2,1-3H3;2*1H |
| InChIKey | UYNYJIDPMZOMAA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride?
The IUPAC name of (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride (CID 75481807) is (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride.
What is the SMILES notation for (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride?
The canonical SMILES for (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride is Cc1nc(C)c(CN)c(C)n1.Cl.Cl.
What is the InChIKey of (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride?
The InChIKey is UYNYJIDPMZOMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3.2ClH/c1-5-8(4-9)6(2)11-7(3)10-5;;/h4,9H2,1-3H3;2*1H.
What are the key properties of (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride?
(2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride has a molecular weight of 224.13 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trimethylpyrimidin-5-yl)methanamine;dihydrochloride is sourced from PubChem (CID 75481807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).