About 2,2-difluoroethylhydrazine;hydrochloride
2,2-difluoroethylhydrazine;hydrochloride (PubChem CID 75481835) has the molecular formula C2H7ClF2N2
and a molecular weight of 132.54 g/mol. Its IUPAC name is 2,2-difluoroethylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-difluoroethylhydrazine;hydrochloride |
| PubChem CID | 75481835 |
| Molecular Formula | C2H7ClF2N2 |
| Molecular Weight | 132.54 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | 2,2-difluoroethylhydrazine;hydrochloride |
| SMILES | Cl.NNCC(F)F |
| InChI | InChI=1S/C2H6F2N2.ClH/c3-2(4)1-6-5;/h2,6H,1,5H2;1H |
| InChIKey | JGPUIHUKHLJRJK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.54 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethylhydrazine;hydrochloride?
The IUPAC name of 2,2-difluoroethylhydrazine;hydrochloride (CID 75481835) is 2,2-difluoroethylhydrazine;hydrochloride.
What is the SMILES notation for 2,2-difluoroethylhydrazine;hydrochloride?
The canonical SMILES for 2,2-difluoroethylhydrazine;hydrochloride is Cl.NNCC(F)F.
What is the InChIKey of 2,2-difluoroethylhydrazine;hydrochloride?
The InChIKey is JGPUIHUKHLJRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6F2N2.ClH/c3-2(4)1-6-5;/h2,6H,1,5H2;1H.
What are the key properties of 2,2-difluoroethylhydrazine;hydrochloride?
2,2-difluoroethylhydrazine;hydrochloride has a molecular weight of 132.54 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethylhydrazine;hydrochloride is sourced from PubChem (CID 75481835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).