C23H27N5OS — CID 7548192
N,N-dimethyl-4-[(2R,5S)-5-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline (PubChem CID 7548192) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2R,5S)-5-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(2R,5S)-5-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline |
|---|---|
| PubChem CID | 7548192 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N,N-dimethyl-4-[(2R,5S)-5-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline |
| SMILES | C=CCn1c(SC[C@@H]2CN[C@@H](c3ccc(N(C)C)cc3)O2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H27N5OS/c1-4-14-28-21(17-8-6-5-7-9-17)25-26-23(28)30-16-20-15-24-22(29-20)18-10-12-19(13-11-18)27(2)3/h4-13,20,22,24H,1,14-16H2,2-3H3/t20-,22+/m0/s1 |
| InChIKey | FVJHLFJBJLNDJQ-RBBKRZOGSA-N |
| XLogP | 3.98 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|