About 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide
1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide (PubChem CID 75482202) has the molecular formula C11H24IN3O
and a molecular weight of 341.24 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide |
| PubChem CID | 75482202 |
| Molecular Formula | C11H24IN3O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/C)NC)C1(C)C.I |
| InChI | InChI=1S/C11H23N3O.HI/c1-6-15-9-7-8(11(9,2)3)14-10(12-4)13-5;/h8-9H,6-7H2,1-5H3,(H2,12,13,14);1H |
| InChIKey | VJMZBBRFWZQELV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide?
The IUPAC name of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide (CID 75482202) is 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide.
What is the SMILES notation for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide?
The canonical SMILES for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide is CCOC1CC(N/C(=N/C)NC)C1(C)C.I.
What is the InChIKey of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide?
The InChIKey is VJMZBBRFWZQELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O.HI/c1-6-15-9-7-8(11(9,2)3)14-10(12-4)13-5;/h8-9H,6-7H2,1-5H3,(H2,12,13,14);1H.
What are the key properties of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide?
1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide has a molecular weight of 341.24 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine;hydroiodide is sourced from PubChem (CID 75482202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).