About 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine
1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine (PubChem CID 75482203) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine |
| PubChem CID | 75482203 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine |
| SMILES | CCOC1CC(N/C(=N/C)NC)C1(C)C |
| InChI | InChI=1S/C11H23N3O/c1-6-15-9-7-8(11(9,2)3)14-10(12-4)13-5/h8-9H,6-7H2,1-5H3,(H2,12,13,14) |
| InChIKey | SFPQJUMYMNUOJD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine?
The IUPAC name of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine (CID 75482203) is 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine.
What is the SMILES notation for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine?
The canonical SMILES for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine is CCOC1CC(N/C(=N/C)NC)C1(C)C.
What is the InChIKey of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine?
The InChIKey is SFPQJUMYMNUOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-6-15-9-7-8(11(9,2)3)14-10(12-4)13-5/h8-9H,6-7H2,1-5H3,(H2,12,13,14).
What are the key properties of 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine?
1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine has a molecular weight of 213.32 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-2,2-dimethylcyclobutyl)-2,3-dimethylguanidine is sourced from PubChem (CID 75482203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).