About N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide
N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide (PubChem CID 75482736) has the molecular formula C11H13F2NO3S
and a molecular weight of 277.29 g/mol. Its IUPAC name is N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide |
| PubChem CID | 75482736 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide |
| SMILES | CC(=O)NCCCS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2NO3S/c1-8(15)14-5-2-6-18(16,17)9-3-4-10(12)11(13)7-9/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | SUQPNTQZELBZJP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide?
The IUPAC name of N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide (CID 75482736) is N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide.
What is the SMILES notation for N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide?
The canonical SMILES for N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide is CC(=O)NCCCS(=O)(=O)c1ccc(F)c(F)c1.
What is the InChIKey of N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide?
The InChIKey is SUQPNTQZELBZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3S/c1-8(15)14-5-2-6-18(16,17)9-3-4-10(12)11(13)7-9/h3-4,7H,2,5-6H2,1H3,(H,14,15).
What are the key properties of N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide?
N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide has a molecular weight of 277.29 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-difluorophenyl)sulfonylpropyl]acetamide is sourced from PubChem (CID 75482736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).