About 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide
2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide (PubChem CID 75482966) has the molecular formula C9H12N2O3S2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 75482966 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCS(=O)(=O)NC(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C9H12N2O3S2/c1-4-5-16(13,14)11-9(12)8-6(2)10-7(3)15-8/h4H,1,5H2,2-3H3,(H,11,12) |
| InChIKey | BHNUVNHNXJYYEC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide (CID 75482966) is 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide is C=CCS(=O)(=O)NC(=O)c1sc(C)nc1C.
What is the InChIKey of 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide?
The InChIKey is BHNUVNHNXJYYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S2/c1-4-5-16(13,14)11-9(12)8-6(2)10-7(3)15-8/h4H,1,5H2,2-3H3,(H,11,12).
What are the key properties of 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide?
2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide has a molecular weight of 260.34 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N-prop-2-enylsulfonyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 75482966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).