C12H19F3N2O3 — CID 75483152
4-hydroxy-N-(2-methyloxolan-3-yl)-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 75483152) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methyloxolan-3-yl)-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | 4-hydroxy-N-(2-methyloxolan-3-yl)-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75483152 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-hydroxy-N-(2-methyloxolan-3-yl)-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | CC1OCCC1NC(=O)N1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-8-9(2-7-20-8)16-10(18)17-5-3-11(19,4-6-17)12(13,14)15/h8-9,19H,2-7H2,1H3,(H,16,18) |
| InChIKey | WFOIGZFGPHFGSP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |