methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate

C15H27NO3 — CID 75483232

IUPACmethyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate
SMILESCOC(=O)CC(C)(C)CC(=O)N1CCCCCC1C
InChIInChI=1S/C15H27NO3/c1-12-8-6-5-7-9-16(12)13(17)10-15(2,3)11-14(18)19-4/h12H,5-11H2,1-4H3
InChIKeySFOFLIQEFFIKGL-UHFFFAOYSA-N
MW269.38 g/mol
LogP2.76
Rot. Bonds4

About methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate

methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate (PubChem CID 75483232) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate.

Molecular Properties

Compound Namemethyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate
PubChem CID75483232
Molecular FormulaC15H27NO3
Molecular Weight269.38 g/mol
Exact Mass269.20
IUPAC Namemethyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate
SMILESCOC(=O)CC(C)(C)CC(=O)N1CCCCCC1C
InChIInChI=1S/C15H27NO3/c1-12-8-6-5-7-9-16(12)13(17)10-15(2,3)11-14(18)19-4/h12H,5-11H2,1-4H3
InChIKeySFOFLIQEFFIKGL-UHFFFAOYSA-N
XLogP2.76
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.38
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate?
The IUPAC name of methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate (CID 75483232) is methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate.
What is the SMILES notation for methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate?
The canonical SMILES for methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate is COC(=O)CC(C)(C)CC(=O)N1CCCCCC1C.
What is the InChIKey of methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate?
The InChIKey is SFOFLIQEFFIKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-12-8-6-5-7-9-16(12)13(17)10-15(2,3)11-14(18)19-4/h12H,5-11H2,1-4H3.
What are the key properties of methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate?
methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate has a molecular weight of 269.38 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-dimethyl-5-(2-methylazepan-1-yl)-5-oxopentanoate is sourced from PubChem (CID 75483232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).