About (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate
(5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate (PubChem CID 75483262) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate.
Molecular Properties
| Compound Name | (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate |
| PubChem CID | 75483262 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate |
| SMILES | CC(C)(C)c1cnc(COC(=O)c2ccn3cncc3c2)o1 |
| InChI | InChI=1S/C16H17N3O3/c1-16(2,3)13-8-18-14(22-13)9-21-15(20)11-4-5-19-10-17-7-12(19)6-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | HNZFYMKZLOAPOF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate?
The IUPAC name of (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate (CID 75483262) is (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate.
What is the SMILES notation for (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate?
The canonical SMILES for (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate is CC(C)(C)c1cnc(COC(=O)c2ccn3cncc3c2)o1.
What is the InChIKey of (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate?
The InChIKey is HNZFYMKZLOAPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-16(2,3)13-8-18-14(22-13)9-21-15(20)11-4-5-19-10-17-7-12(19)6-11/h4-8,10H,9H2,1-3H3.
What are the key properties of (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate?
(5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate has a molecular weight of 299.33 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,3-oxazol-2-yl)methyl imidazo[1,5-a]pyridine-7-carboxylate is sourced from PubChem (CID 75483262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).