About (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate
(1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate (PubChem CID 75483263) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate.
Molecular Properties
| Compound Name | (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate |
| PubChem CID | 75483263 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate |
| SMILES | COCC(OC(=O)c1ccn2cncc2c1)C(C)C |
| InChI | InChI=1S/C14H18N2O3/c1-10(2)13(8-18-3)19-14(17)11-4-5-16-9-15-7-12(16)6-11/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | OYIKUFSLZIAUPG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate?
The IUPAC name of (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate (CID 75483263) is (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate.
What is the SMILES notation for (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate?
The canonical SMILES for (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate is COCC(OC(=O)c1ccn2cncc2c1)C(C)C.
What is the InChIKey of (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate?
The InChIKey is OYIKUFSLZIAUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-10(2)13(8-18-3)19-14(17)11-4-5-16-9-15-7-12(16)6-11/h4-7,9-10,13H,8H2,1-3H3.
What are the key properties of (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate?
(1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate has a molecular weight of 262.31 g/mol, XLogP of 2.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxy-3-methylbutan-2-yl) imidazo[1,5-a]pyridine-7-carboxylate is sourced from PubChem (CID 75483263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).