About 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide
1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 75483842) has the molecular formula C10H9FN2O3S
and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide |
| PubChem CID | 75483842 |
| Molecular Formula | C10H9FN2O3S |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)Nc1ccon1 |
| InChI | InChI=1S/C10H9FN2O3S/c11-9-3-1-2-8(6-9)7-17(14,15)13-10-4-5-16-12-10/h1-6H,7H2,(H,12,13) |
| InChIKey | BXQOUDLLBDYBEJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide?
The IUPAC name of 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide (CID 75483842) is 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide.
What is the SMILES notation for 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide?
The canonical SMILES for 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide is O=S(=O)(Cc1cccc(F)c1)Nc1ccon1.
What is the InChIKey of 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide?
The InChIKey is BXQOUDLLBDYBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O3S/c11-9-3-1-2-8(6-9)7-17(14,15)13-10-4-5-16-12-10/h1-6H,7H2,(H,12,13).
What are the key properties of 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide?
1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide has a molecular weight of 256.26 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenyl)-N-(1,2-oxazol-3-yl)methanesulfonamide is sourced from PubChem (CID 75483842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).