C11H16N4O2 — CID 75483897
4-(4,6-dimethylpyrimidin-2-yl)morpholine-3-carboxamide (PubChem CID 75483897) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)morpholine-3-carboxamide.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 75483897 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)morpholine-3-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCOCC2C(N)=O)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-7-5-8(2)14-11(13-7)15-3-4-17-6-9(15)10(12)16/h5,9H,3-4,6H2,1-2H3,(H2,12,16) |
| InChIKey | KHKCOXUSOYYXJA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |