About 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole
4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole (PubChem CID 75484128) has the molecular formula C12H12ClN3O2S
and a molecular weight of 297.77 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole.
Molecular Properties
| Compound Name | 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole |
| PubChem CID | 75484128 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole |
| SMILES | Clc1ccc(C2OCC(CSc3cn[nH]n3)O2)cc1 |
| InChI | InChI=1S/C12H12ClN3O2S/c13-9-3-1-8(2-4-9)12-17-6-10(18-12)7-19-11-5-14-16-15-11/h1-5,10,12H,6-7H2,(H,14,15,16) |
| InChIKey | RHZPGUCQZMCYDW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole?
The IUPAC name of 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole (CID 75484128) is 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole.
What is the SMILES notation for 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole?
The canonical SMILES for 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole is Clc1ccc(C2OCC(CSc3cn[nH]n3)O2)cc1.
What is the InChIKey of 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole?
The InChIKey is RHZPGUCQZMCYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2S/c13-9-3-1-8(2-4-9)12-17-6-10(18-12)7-19-11-5-14-16-15-11/h1-5,10,12H,6-7H2,(H,14,15,16).
What are the key properties of 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole?
4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole has a molecular weight of 297.77 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methylsulfanyl]-2H-triazole is sourced from PubChem (CID 75484128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).