C14H18N4O2 — CID 75484568
N-(4-methoxybutan-2-yl)-2-(triazol-1-yl)benzamide (PubChem CID 75484568) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)-2-(triazol-1-yl)benzamide.
| Compound Name | N-(4-methoxybutan-2-yl)-2-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 75484568 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(4-methoxybutan-2-yl)-2-(triazol-1-yl)benzamide |
| SMILES | COCCC(C)NC(=O)c1ccccc1-n1ccnn1 |
| InChI | InChI=1S/C14H18N4O2/c1-11(7-10-20-2)16-14(19)12-5-3-4-6-13(12)18-9-8-15-17-18/h3-6,8-9,11H,7,10H2,1-2H3,(H,16,19) |
| InChIKey | ZWEXMKNZCQYZGB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |