About 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea
3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea (PubChem CID 75485066) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea |
| PubChem CID | 75485066 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea |
| SMILES | CCOc1cccc(NC(=O)N(CC)CC)n1 |
| InChI | InChI=1S/C12H19N3O2/c1-4-15(5-2)12(16)14-10-8-7-9-11(13-10)17-6-3/h7-9H,4-6H2,1-3H3,(H,13,14,16) |
| InChIKey | YHTYZBCIJKGYPM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea?
The IUPAC name of 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea (CID 75485066) is 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea.
What is the SMILES notation for 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea?
The canonical SMILES for 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea is CCOc1cccc(NC(=O)N(CC)CC)n1.
What is the InChIKey of 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea?
The InChIKey is YHTYZBCIJKGYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-4-15(5-2)12(16)14-10-8-7-9-11(13-10)17-6-3/h7-9H,4-6H2,1-3H3,(H,13,14,16).
What are the key properties of 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea?
3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea has a molecular weight of 237.30 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-ethoxy-2-pyridinyl)-1,1-diethylurea is sourced from PubChem (CID 75485066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).