C20H22N2O5 — CID 7548524
2,3-dimethoxy-N-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide (PubChem CID 7548524) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 7548524 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2,3-dimethoxy-N-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide |
| SMILES | COc1ccc(N2C[C@H](NC(=O)c3cccc(OC)c3OC)CC2=O)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-25-15-9-7-14(8-10-15)22-12-13(11-18(22)23)21-20(24)16-5-4-6-17(26-2)19(16)27-3/h4-10,13H,11-12H2,1-3H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | ORIJIMCVLQEDPP-CYBMUJFWSA-N |
| XLogP | 2.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |