About 2,4-dichloropyrimidine;hydrochloride
2,4-dichloropyrimidine;hydrochloride (PubChem CID 75485240) has the molecular formula C4H3Cl3N2
and a molecular weight of 185.44 g/mol. Its IUPAC name is 2,4-dichloropyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dichloropyrimidine;hydrochloride |
| PubChem CID | 75485240 |
| Molecular Formula | C4H3Cl3N2 |
| Molecular Weight | 185.44 g/mol |
| Exact Mass | 183.94 |
| IUPAC Name | 2,4-dichloropyrimidine;hydrochloride |
| SMILES | Cl.Clc1ccnc(Cl)n1 |
| InChI | InChI=1S/C4H2Cl2N2.ClH/c5-3-1-2-7-4(6)8-3;/h1-2H;1H |
| InChIKey | BUTPLPMMPOKGNI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloropyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloropyrimidine;hydrochloride?
The IUPAC name of 2,4-dichloropyrimidine;hydrochloride (CID 75485240) is 2,4-dichloropyrimidine;hydrochloride.
What is the SMILES notation for 2,4-dichloropyrimidine;hydrochloride?
The canonical SMILES for 2,4-dichloropyrimidine;hydrochloride is Cl.Clc1ccnc(Cl)n1.
What is the InChIKey of 2,4-dichloropyrimidine;hydrochloride?
The InChIKey is BUTPLPMMPOKGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl2N2.ClH/c5-3-1-2-7-4(6)8-3;/h1-2H;1H.
What are the key properties of 2,4-dichloropyrimidine;hydrochloride?
2,4-dichloropyrimidine;hydrochloride has a molecular weight of 185.44 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloropyrimidine;hydrochloride is sourced from PubChem (CID 75485240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).