C6H12N10O6 — CID 75485528
5-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazol-3-amine;bis(nitric acid) (PubChem CID 75485528) has the molecular formula C6H12N10O6 and a molecular weight of 320.23 g/mol. Its IUPAC name is 5-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazol-3-amine;bis(nitric acid).
| Compound Name | 5-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazol-3-amine;bis(nitric acid) |
|---|---|
| PubChem CID | 75485528 |
| Molecular Formula | C6H12N10O6 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-1H-1,2,4-triazol-3-amine;bis(nitric acid) |
| SMILES | Nc1n[nH]c(CCc2nc(N)n[nH]2)n1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C6H10N8.2HNO3/c7-5-9-3(11-13-5)1-2-4-10-6(8)14-12-4;2*2-1(3)4/h1-2H2,(H3,7,9,11,13)(H3,8,10,12,14);2*(H,2,3,4) |
| InChIKey | BAVHUKAMANZQAF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 261.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|