C19H24BNO4 — CID 75486565
N-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide (PubChem CID 75486565) has the molecular formula C19H24BNO4 and a molecular weight of 341.22 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 75486565 |
| Molecular Formula | C19H24BNO4 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)NCCO)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C19H24BNO4/c1-18(2)19(3,4)25-20(24-18)16-10-9-15(17(23)21-11-12-22)13-7-5-6-8-14(13)16/h5-10,22H,11-12H2,1-4H3,(H,21,23) |
| InChIKey | ZQQKGZAEXMHPCM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|