C17H19BFNO5 — CID 75486632
methyl 5-fluoro-4-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-2-carboxylate (PubChem CID 75486632) has the molecular formula C17H19BFNO5 and a molecular weight of 347.15 g/mol. Its IUPAC name is methyl 5-fluoro-4-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-2-carboxylate.
| Compound Name | methyl 5-fluoro-4-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 75486632 |
| Molecular Formula | C17H19BFNO5 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | methyl 5-fluoro-4-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c2c(F)ccc(B3OC(C)(C)C(C)(C)O3)c2[nH]1 |
| InChI | InChI=1S/C17H19BFNO5/c1-16(2)17(3,4)25-18(24-16)9-6-7-10(19)13-12(21)8-11(15(22)23-5)20-14(9)13/h6-8H,1-5H3,(H,20,21) |
| InChIKey | RFNHWYLCSUWYON-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|