C14H19BF3NO2 — CID 75486665
N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline (PubChem CID 75486665) has the molecular formula C14H19BF3NO2 and a molecular weight of 301.12 g/mol. Its IUPAC name is N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline.
| Compound Name | N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 75486665 |
| Molecular Formula | C14H19BF3NO2 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)aniline |
| SMILES | CNc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H19BF3NO2/c1-12(2)13(3,4)21-15(20-12)10-7-6-9(14(16,17)18)8-11(10)19-5/h6-8,19H,1-5H3 |
| InChIKey | BBYXQKQNGLXQDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|